Compound Q&A

What industries use Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

Answer

Methyl 3-(trifluoromethyl)benzoate
Methyl 3-(trifluoromethyl)benzoate is used in the pharmaceutical industry as an intermediate for the synthesis of various pharmaceutical compounds. It is also utilized in the polymer industry for producing functionalized polymers and in sensor technology for detecting specific chemical species. Additionally, it finds applications in the semiconductor industry in certain etching processes.

About

CAS No 2557-13-3
English Name Methyl 3-(trifluoromethyl)benzoate
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES COC(=O)C1=CC(=CC=C1)C(F)(F)F
InChIKey QQHNNQCWKYFNAC-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

Methyl 3-(trifluoromethyl)benzoate is a colorless to light yellow crystalline solid with a molecular...

Compound Q&A

How is Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3) typically synthesized?

Methyl 3-(trifluoromethyl)benzoate is typically synthesized by the methylation of 3-(trifluoromethyl...

Compound Q&A

What precautions should be taken when handling Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

When handling Methyl 3-(trifluoromethyl)benzoate, appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...