Compound Q&A

How is Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3) typically synthesized?

Answer

Methyl 3-(trifluoromethyl)benzoate
Methyl 3-(trifluoromethyl)benzoate is typically synthesized by the methylation of 3-(trifluoromethyl)benzoic acid using methyl iodide in the presence of a base like sodium hydride. The reaction is carried out in a solvent such as dimethylformamide (DMF) at room temperature, with a yield of around 80-85%. The reaction involves the formation of a triflate intermediate which then reacts with methyl iodide to form the desired product.

About

CAS No 2557-13-3
English Name Methyl 3-(trifluoromethyl)benzoate
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES COC(=O)C1=CC(=CC=C1)C(F)(F)F
InChIKey QQHNNQCWKYFNAC-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

Methyl 3-(trifluoromethyl)benzoate is a colorless to light yellow crystalline solid with a molecular...

Compound Q&A

What industries use Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

Methyl 3-(trifluoromethyl)benzoate is used in the pharmaceutical industry as an intermediate for the...

Compound Q&A

What precautions should be taken when handling Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

When handling Methyl 3-(trifluoromethyl)benzoate, appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...