Compound Q&A

What are the physical and chemical properties of Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

Answer

Methyl 3-(trifluoromethyl)benzoate
Methyl 3-(trifluoromethyl)benzoate is a colorless to light yellow crystalline solid with a molecular weight of approximately 228.14 g/mol. It has a pKa of about 2.9 and a melting point of 65-66°C. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. It is an electrophilic aromatic compound and is relatively stable but can undergo substitution reactions under certain conditions.

About

CAS No 2557-13-3
English Name Methyl 3-(trifluoromethyl)benzoate
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES COC(=O)C1=CC(=CC=C1)C(F)(F)F
InChIKey QQHNNQCWKYFNAC-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3) typically synthesized?

Methyl 3-(trifluoromethyl)benzoate is typically synthesized by the methylation of 3-(trifluoromethyl...

Compound Q&A

What industries use Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

Methyl 3-(trifluoromethyl)benzoate is used in the pharmaceutical industry as an intermediate for the...

Compound Q&A

What precautions should be taken when handling Methyl 3-(trifluoromethyl)benzoate (CAS: 2557-13-3)?

When handling Methyl 3-(trifluoromethyl)benzoate, appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...