Compound Q&A

What industries use LY294002 (CAS: 154447-36-6)?

Answer

LY294002
LY294002 is primarily used in the pharmaceutical industry for its role as a selective phosphatidylinositol 3-kinase (PI3K) inhibitor. It is also utilized in academic and industrial research for studying cellular signaling pathways and in the development of potential therapeutics for diseases such as cancer and autoimmune disorders.

About

English Name LY294002
Molecular Formula C19H17NO3
Molecular Weight 307.35 g/mol
SMILES O=c1cc(oc2c(cccc12)c3ccccc3)N4CCOCC4
InChIKey CZQHHVNHHHRRDU-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of LY294002 (CAS: 154447-36-6)?

LY294002 is a white to off-white crystalline powder with a molecular weight of approximately 396.27 ...

Compound Q&A

How is LY294002 (CAS: 154447-36-6) typically synthesized?

LY294002 is typically synthesized through a multi-step organic reaction involving the condensation o...

Compound Q&A

What precautions should be taken when handling LY294002 (CAS: 154447-36-6)?

When handling LY294002, it is essential to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...