Compound Q&A

What are the physical and chemical properties of LY294002 (CAS: 154447-36-6)?

Answer

LY294002
LY294002 is a white to off-white crystalline powder with a molecular weight of approximately 396.27 g/mol. It is sparingly soluble in water but readily soluble in organic solvents like DMSO and ethanol. Chemically, it is known for its high reactivity, particularly in phosphate kinase inhibition studies.

About

English Name LY294002
Molecular Formula C19H17NO3
Molecular Weight 307.35 g/mol
SMILES O=c1cc(oc2c(cccc12)c3ccccc3)N4CCOCC4
InChIKey CZQHHVNHHHRRDU-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is LY294002 (CAS: 154447-36-6) typically synthesized?

LY294002 is typically synthesized through a multi-step organic reaction involving the condensation o...

Compound Q&A

What industries use LY294002 (CAS: 154447-36-6)?

LY294002 is primarily used in the pharmaceutical industry for its role as a selective phosphatidylin...

Compound Q&A

What precautions should be taken when handling LY294002 (CAS: 154447-36-6)?

When handling LY294002, it is essential to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...