Compound Q&A

How is 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4) typically synthesized?

Answer

3,5-Dimethoxybenzoic acid
3,5-Dimethoxybenzoic acid is typically synthesized by the methylation of 3,5-dihydroxybenzoic acid using a methylating agent like methyl iodide in the presence of a base such as sodium hydroxide. The reaction is carried out in an aprotic solvent like dimethylformamide (DMF) to achieve a high yield and selectivity.

About

CAS No 1132-21-4
English Name 3,5-Dimethoxybenzoic acid
Molecular Formula C9H10O4
Molecular Weight 182.17 g/mol
SMILES COC1=CC(=CC(=C1)C(=O)O)OC
InChIKey IWPZKOJSYQZABD-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4)?

3,5-Dimethoxybenzoic acid (CAS: 1132-21-4) is a crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4)?

3,5-Dimethoxybenzoic acid (CAS: 1132-21-4) is used in various industries, including pharmaceuticals ...

Compound Q&A

What precautions should be taken when handling 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4)?

When handling 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4), it is important to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...