Compound Q&A

What are the physical and chemical properties of 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4)?

Answer

3,5-Dimethoxybenzoic acid
3,5-Dimethoxybenzoic acid (CAS: 1132-21-4) is a crystalline solid with a molecular weight of approximately 188.16 g/mol. It has a melting point of 225-227°C and a pKa of about 4.1. The acid is moderately soluble in water and ethanol, but less soluble in other organic solvents. It is chemically reactive, especially towards nucleophiles and bases.

About

CAS No 1132-21-4
English Name 3,5-Dimethoxybenzoic acid
Molecular Formula C9H10O4
Molecular Weight 182.17 g/mol
SMILES COC1=CC(=CC(=C1)C(=O)O)OC
InChIKey IWPZKOJSYQZABD-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4) typically synthesized?

3,5-Dimethoxybenzoic acid is typically synthesized by the methylation of 3,5-dihydroxybenzoic acid u...

Compound Q&A

What industries use 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4)?

3,5-Dimethoxybenzoic acid (CAS: 1132-21-4) is used in various industries, including pharmaceuticals ...

Compound Q&A

What precautions should be taken when handling 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4)?

When handling 3,5-Dimethoxybenzoic acid (CAS: 1132-21-4), it is important to use appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...