Compound Q&A

How is (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8) typically synthesized?

Answer

(2-Chlorophenyl)(phenyl)methanone
(2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8) can be synthesized via the condensation reaction of 2-chloroacetophenone and phenylhydrazine. This reaction is typically carried out in the presence of a base like sodium hydroxide to facilitate the formation of the intermediate hydrazone, which then undergoes condensation. The yield is generally good, around 70-80%, and the method is suitable for both laboratory and industrial scale production.

About

CAS No 5162-03-8
English Name (2-Chlorophenyl)(phenyl)methanone
Molecular Formula C13H9ClO
Molecular Weight 216.67 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=CC=CC=C2Cl
InChIKey VMHYWKBKHMYRNF-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8)?

(2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8) is an organic compound with a molecular weight of...

Compound Q&A

What industries use (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8)?

(2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8) is used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8)?

When handling (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8), it is crucial to follow standard l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...