Compound Q&A

What are the physical and chemical properties of (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8)?

Answer

(2-Chlorophenyl)(phenyl)methanone
(2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8) is an organic compound with a molecular weight of approximately 211.17 g/mol. It is a white crystalline solid with a melting point around 78-80°C. The compound is slightly soluble in water but highly soluble in common organic solvents like ethanol and acetone. It exhibits moderate reactivity with nucleophiles and is used in various chemical reactions due to its functional groups. Its solubility and reactivity make it suitable for applications in pharmaceuticals and organic synthesis.

About

CAS No 5162-03-8
English Name (2-Chlorophenyl)(phenyl)methanone
Molecular Formula C13H9ClO
Molecular Weight 216.67 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=CC=CC=C2Cl
InChIKey VMHYWKBKHMYRNF-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8) typically synthesized?

(2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8) can be synthesized via the condensation reaction ...

Compound Q&A

What industries use (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8)?

(2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8) is used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8)?

When handling (2-Chlorophenyl)(phenyl)methanone (CAS: 5162-03-8), it is crucial to follow standard l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...