Compound Q&A

What industries use (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol (CAS: 643-12-9)?

Answer

(1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol
(1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol is primarily used in the pharmaceutical industry for the synthesis of chiral intermediates and pharmaceuticals. It is also used in the polymer industry for the modification of polymer properties and in the sensor technology for the development of chemical sensors due to its unique structural features.

About

CAS No 643-12-9
English Name (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol
Molecular Formula C6H12O6
Molecular Weight 180.16 g/mol
SMILES [C@@H]1([C@@H]([C@@H]([C@H]([C@@H]([C@H]1O)O)O)O)O)O
InChIKey CDAISMWEOUEBRE-LKPKBOIGSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol (CAS: 643-12-9)?

(1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol, also known as 1,2,3,4,5,6-Cyclohexanetetrol, is a ...

Compound Q&A

How is (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol (CAS: 643-12-9) typically synthesized?

(1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol can be synthesized via a stereoselective hydrogenat...

Compound Q&A

What precautions should be taken when handling (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol (CAS: 643-12-9)?

When handling (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol, proper personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...