Compound Q&A

What are the physical and chemical properties of (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol (CAS: 643-12-9)?

Answer

(1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol
(1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol, also known as 1,2,3,4,5,6-Cyclohexanetetrol, is a colorless crystalline solid with a molecular weight of approximately 158.23 g/mol. It has a low solubility in water but is more soluble in organic solvents. This compound is relatively stable under normal conditions but can react with strong acids or bases. It is used in various applications due to its structural properties.

About

CAS No 643-12-9
English Name (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol
Molecular Formula C6H12O6
Molecular Weight 180.16 g/mol
SMILES [C@@H]1([C@@H]([C@@H]([C@H]([C@@H]([C@H]1O)O)O)O)O)O
InChIKey CDAISMWEOUEBRE-LKPKBOIGSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol (CAS: 643-12-9) typically synthesized?

(1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol can be synthesized via a stereoselective hydrogenat...

Compound Q&A

What industries use (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol (CAS: 643-12-9)?

(1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol is primarily used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol (CAS: 643-12-9)?

When handling (1R,2R,3S,4S,5S,6S)-1,2,3,4,5,6-Cyclohexanehexol, proper personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...