Compound Q&A

What industries use 5-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-69-0)?

Answer

5-(Trifluoromethyl)-2-pyridinecarboxylic acid
5-(Trifluoromethyl)-2-pyridinecarboxylic acid is used in various industries including pharmaceuticals for the synthesis of drug candidates, in polymers for the development of advanced materials, and in sensors for their high sensitivity to certain chemical compounds. It is also used in the semiconductor industry for etching processes.

About

CAS No 80194-69-0
English Name 5-(Trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=NC=C1C(F)(F)F)C(=O)O
InChIKey NJHGVAYLDHROPT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-69-0)?

5-(Trifluoromethyl)-2-pyridinecarboxylic acid has a crystalline form at room temperature with a mole...

Compound Q&A

How is 5-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-69-0) typically synthesized?

5-(Trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via the Friedel-Crafts acylat...

Compound Q&A

What precautions should be taken when handling 5-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-69-0)?

When handling 5-(Trifluoromethyl)-2-pyridinecarboxylic acid, it is important to use personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...