Compound Q&A

What are the physical and chemical properties of 5-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-69-0)?

Answer

5-(Trifluoromethyl)-2-pyridinecarboxylic acid
5-(Trifluoromethyl)-2-pyridinecarboxylic acid has a crystalline form at room temperature with a molecular weight of approximately 217.08 g/mol. It is slightly soluble in water but soluble in organic solvents. This compound is known for its high reactivity, particularly towards nucleophilic substitution reactions. It reacts readily with amines and alcohols to form amides and esters, respectively.

About

CAS No 80194-69-0
English Name 5-(Trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=NC=C1C(F)(F)F)C(=O)O
InChIKey NJHGVAYLDHROPT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 5-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-69-0) typically synthesized?

5-(Trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via the Friedel-Crafts acylat...

Compound Q&A

What industries use 5-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-69-0)?

5-(Trifluoromethyl)-2-pyridinecarboxylic acid is used in various industries including pharmaceutical...

Compound Q&A

What precautions should be taken when handling 5-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 80194-69-0)?

When handling 5-(Trifluoromethyl)-2-pyridinecarboxylic acid, it is important to use personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...