Compound Q&A

What industries use Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

Answer

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate
Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) is used in various industries. It is particularly valuable in the pharmaceutical sector for the synthesis of complex compounds. It is also utilized in the polymer industry to enhance material properties. Additionally, it finds applications in the production of sensors and semiconductors due to its reactive functional groups.

About

CAS No 21544-03-6
English Name Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate
Molecular Formula C14H18O6
Molecular Weight 282.29 g/mol
SMILES C1C=CCC(C1C(=O)OCC2CO2)C(=O)OCC3CO3
InChIKey KTPIWUHKYIJBCR-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) is a solid at room temperatu...

Compound Q&A

How is Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) typically synthesized?

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) can be synthesized via a two...

Compound Q&A

What precautions should be taken when handling Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

When handling Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6), it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...