Compound Q&A

What are the physical and chemical properties of Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

Answer

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate
Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) is a solid at room temperature. Its molecular weight is approximately 268.36 g/mol. It has limited solubility in water but is soluble in organic solvents like methylene chloride. This compound is reactive, particularly with nucleophiles due to the presence of oxirane rings and carboxylic acid groups.

About

CAS No 21544-03-6
English Name Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate
Molecular Formula C14H18O6
Molecular Weight 282.29 g/mol
SMILES C1C=CCC(C1C(=O)OCC2CO2)C(=O)OCC3CO3
InChIKey KTPIWUHKYIJBCR-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) typically synthesized?

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) can be synthesized via a two...

Compound Q&A

What industries use Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) is used in various industrie...

Compound Q&A

What precautions should be taken when handling Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

When handling Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6), it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...