Compound Q&A

How is Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) typically synthesized?

Answer

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate
Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) can be synthesized via a two-step process. First, the 4-cyclohexene-1,2-dicarboxylic acid is reacted with epichlorohydrin to form the oxirane derivatives. Then, these derivatives are coupled to form the bis(2-oxiranylmethyl) derivative. Commonly used catalysts include triphenylphosphine and 4-dimethylaminopyridine, and the yield is typically over 90%.

About

CAS No 21544-03-6
English Name Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate
Molecular Formula C14H18O6
Molecular Weight 282.29 g/mol
SMILES C1C=CCC(C1C(=O)OCC2CO2)C(=O)OCC3CO3
InChIKey KTPIWUHKYIJBCR-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) is a solid at room temperatu...

Compound Q&A

What industries use Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6) is used in various industrie...

Compound Q&A

What precautions should be taken when handling Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6)?

When handling Bis(2-oxiranylmethyl) 4-cyclohexene-1,2-dicarboxylate (CAS: 21544-03-6), it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...