Compound Q&A

What industries use Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

Answer

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate
Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is used in the pharmaceutical industry for developing novel drugs and as a precursor in organic synthesis. It is also utilized in the polymer industry for modifying polymer properties, and in the sensor and semiconductor industries due to its unique chemical reactivity and stability.

About

CAS No 16466-61-8
English Name Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate
Molecular Formula C10H20N2O4
Molecular Weight 232.28 g/mol
SMILES CC(C)(C)OC(=O)NNC(=O)OC(C)(C)C
InChIKey TYSZETYVESRFNT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is a crystalline compound with...

Compound Q&A

How is Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) typically synthesized?

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is synthesized through a multi...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

When handling Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...