Compound Q&A

How is Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) typically synthesized?

Answer

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate
Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is synthesized through a multi-step process involving the condensation of hydrazine and 1,2-dicarboxylic acid derivatives of 2-methyl-2-propanol. The reaction is catalyzed by acid or base, and the yield is typically high with good selectivity. This method allows for the controlled formation of the desired product with minimal by-products.

About

CAS No 16466-61-8
English Name Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate
Molecular Formula C10H20N2O4
Molecular Weight 232.28 g/mol
SMILES CC(C)(C)OC(=O)NNC(=O)OC(C)(C)C
InChIKey TYSZETYVESRFNT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is a crystalline compound with...

Compound Q&A

What industries use Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

When handling Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...