Compound Q&A

What are the physical and chemical properties of Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

Answer

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate
Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is a crystalline compound with a molecular weight of approximately 188.23 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and methanol. Chemically, it is highly reactive, particularly in nucleophilic substitution reactions and is used in various synthetic pathways due to its ability to form stable adducts.

About

CAS No 16466-61-8
English Name Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate
Molecular Formula C10H20N2O4
Molecular Weight 232.28 g/mol
SMILES CC(C)(C)OC(=O)NNC(=O)OC(C)(C)C
InChIKey TYSZETYVESRFNT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) typically synthesized?

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is synthesized through a multi...

Compound Q&A

What industries use Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8) is used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8)?

When handling Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate (CAS: 16466-61-8), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...