Compound Q&A

What industries use 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

Answer

4-Methyl-3-nitro-2-pyridinamine
4-Methyl-3-nitro-2-pyridinamine is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also employed in the sensor technology sector for its ability to act as a sensing material. Additionally, it has applications in the semiconductor industry due to its unique electronic properties, and in the polymer industry for its potential as a precursor or additive.

About

CAS No 6635-86-5
English Name 4-Methyl-3-nitro-2-pyridinamine
Molecular Formula C6H7N3O2
Molecular Weight 153.14 g/mol
SMILES CC1=C(C(=NC=C1)N)[N+](=O)[O-]
InChIKey IKMZGACFMXZAAT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

4-Methyl-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximately 192....

Compound Q&A

How is 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5) typically synthesized?

4-Methyl-3-nitro-2-pyridinamine is typically synthesized via an intermediate nitration of 4-methyl-2...

Compound Q&A

What precautions should be taken when handling 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

When handling 4-Methyl-3-nitro-2-pyridinamine, it is crucial to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...