Compound Q&A

What are the physical and chemical properties of 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

Answer

4-Methyl-3-nitro-2-pyridinamine
4-Methyl-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximately 192.13 g/mol. It has a solubility of about 10 mg/mL in water and is sparingly soluble in common organic solvents. This compound is known to be moderately reactive, particularly towards nucleophiles and reducing agents, making it useful in various organic reactions.

About

CAS No 6635-86-5
English Name 4-Methyl-3-nitro-2-pyridinamine
Molecular Formula C6H7N3O2
Molecular Weight 153.14 g/mol
SMILES CC1=C(C(=NC=C1)N)[N+](=O)[O-]
InChIKey IKMZGACFMXZAAT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5) typically synthesized?

4-Methyl-3-nitro-2-pyridinamine is typically synthesized via an intermediate nitration of 4-methyl-2...

Compound Q&A

What industries use 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

4-Methyl-3-nitro-2-pyridinamine is used in the pharmaceutical industry for the synthesis of certain ...

Compound Q&A

What precautions should be taken when handling 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

When handling 4-Methyl-3-nitro-2-pyridinamine, it is crucial to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...