Compound Q&A

How is 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5) typically synthesized?

Answer

4-Methyl-3-nitro-2-pyridinamine
4-Methyl-3-nitro-2-pyridinamine is typically synthesized via an intermediate nitration of 4-methyl-2-pyridamine followed by reduction of the nitro group. Commonly, this process involves the use of nitric acid and sulfuric acid as the nitration reagents, followed by hydrogenation to reduce the nitro group to an amine. The overall yield is around 85-90%.

About

CAS No 6635-86-5
English Name 4-Methyl-3-nitro-2-pyridinamine
Molecular Formula C6H7N3O2
Molecular Weight 153.14 g/mol
SMILES CC1=C(C(=NC=C1)N)[N+](=O)[O-]
InChIKey IKMZGACFMXZAAT-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

4-Methyl-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximately 192....

Compound Q&A

What industries use 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

4-Methyl-3-nitro-2-pyridinamine is used in the pharmaceutical industry for the synthesis of certain ...

Compound Q&A

What precautions should be taken when handling 4-Methyl-3-nitro-2-pyridinamine (CAS: 6635-86-5)?

When handling 4-Methyl-3-nitro-2-pyridinamine, it is crucial to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...