Compound Q&A

What industries use 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

Answer

4,4-Bis(4-hydroxyphenyl)pentanoic acid
4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor for the synthesis of various drug molecules and can be used to improve the properties of certain polymers, such as increasing their mechanical strength and thermal stability. Additionally, it has potential applications in the development of sensors and semiconductors.

About

CAS No 126-00-1
English Name 4,4-Bis(4-hydroxyphenyl)pentanoic acid
Molecular Formula C17H18O4
Molecular Weight 286.33 g/mol
SMILES CC(CCC(=O)O)(c1ccc(O)cc1)c2ccc(O)cc2
InChIKey VKOUCJUTMGHNOR-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) is a white crystalline solid with a molecular...

Compound Q&A

How is 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) typically synthesized?

4,4-Bis(4-hydroxyphenyl)pentanoic acid can be synthesized through a condensation reaction of 4-hydro...

Compound Q&A

What precautions should be taken when handling 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

When handling 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...