Compound Q&A

What are the physical and chemical properties of 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

Answer

4,4-Bis(4-hydroxyphenyl)pentanoic acid
4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) is a white crystalline solid with a molecular weight of approximately 298.28 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable under normal conditions, but it can undergo hydrolysis under acidic or basic conditions. It is not reactive towards common organic reagents but can participate in condensation reactions under certain conditions.

About

CAS No 126-00-1
English Name 4,4-Bis(4-hydroxyphenyl)pentanoic acid
Molecular Formula C17H18O4
Molecular Weight 286.33 g/mol
SMILES CC(CCC(=O)O)(c1ccc(O)cc1)c2ccc(O)cc2
InChIKey VKOUCJUTMGHNOR-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) typically synthesized?

4,4-Bis(4-hydroxyphenyl)pentanoic acid can be synthesized through a condensation reaction of 4-hydro...

Compound Q&A

What industries use 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) is primarily used in the pharmaceutical and p...

Compound Q&A

What precautions should be taken when handling 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

When handling 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...