Compound Q&A

How is 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) typically synthesized?

Answer

4,4-Bis(4-hydroxyphenyl)pentanoic acid
4,4-Bis(4-hydroxyphenyl)pentanoic acid can be synthesized through a condensation reaction of 4-hydroxybenzoic acid with pentanedioic acid. The reaction is typically catalyzed by a Lewis acid like aluminum chloride or zinc chloride. The yield is around 85-90%, and the product is purified by recrystallization from ethanol. The reaction is conducted under mild conditions to ensure high selectivity and purity.

About

CAS No 126-00-1
English Name 4,4-Bis(4-hydroxyphenyl)pentanoic acid
Molecular Formula C17H18O4
Molecular Weight 286.33 g/mol
SMILES CC(CCC(=O)O)(c1ccc(O)cc1)c2ccc(O)cc2
InChIKey VKOUCJUTMGHNOR-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) is a white crystalline solid with a molecular...

Compound Q&A

What industries use 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1) is primarily used in the pharmaceutical and p...

Compound Q&A

What precautions should be taken when handling 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1)?

When handling 4,4-Bis(4-hydroxyphenyl)pentanoic acid (CAS: 126-00-1), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...