Compound Q&A

What industries use 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

Answer

10-Deacetyl-7-xylosyl Paclitaxel
10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is primarily used in the pharmaceutical industry for the development of anticancer drugs. It is also of interest in the agricultural sector for its potential as a plant growth regulator. Additionally, it may have applications in the food industry as a preservative and in the development of sensors and semiconductors due to its chemical structure.

About

CAS No 90332-63-1
English Name 10-Deacetyl-7-xylosyl Paclitaxel
Molecular Formula C50H57NO17
Molecular Weight 944 g/mol
SMILES CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)OC8C(C(C(CO8)O)O)O)C)O
InChIKey ORKLEZFXASNLFJ-DYLQFHMVSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is a crystalline compound with a molecular weight...

Compound Q&A

How is 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) typically synthesized?

10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is synthesized through a series of chemical react...

Compound Q&A

What precautions should be taken when handling 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

When handling 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1), it is crucial to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...