Compound Q&A

How is 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) typically synthesized?

Answer

10-Deacetyl-7-xylosyl Paclitaxel
10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is synthesized through a series of chemical reactions, often starting from the natural product paclitaxel. The synthesis involves deacetylation and glycosylation steps. Commonly used catalysts include strong acids like trifluoroacetic acid. The reaction yields are typically around 70-80%, and the process requires careful control of reaction conditions to achieve the desired selectivity.

About

CAS No 90332-63-1
English Name 10-Deacetyl-7-xylosyl Paclitaxel
Molecular Formula C50H57NO17
Molecular Weight 944 g/mol
SMILES CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)OC8C(C(C(CO8)O)O)O)C)O
InChIKey ORKLEZFXASNLFJ-DYLQFHMVSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is a crystalline compound with a molecular weight...

Compound Q&A

What industries use 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

When handling 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1), it is crucial to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...