Compound Q&A

What are the physical and chemical properties of 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

Answer

10-Deacetyl-7-xylosyl Paclitaxel
10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is a crystalline compound with a molecular weight of approximately 645.8 g/mol. It has a low solubility in water but is soluble in organic solvents such as methanol and ethanol. Chemically, it is relatively stable but can react with strong oxidizers. It is typically used in pharmaceutical applications due to its structural complexity and biological activity.

About

CAS No 90332-63-1
English Name 10-Deacetyl-7-xylosyl Paclitaxel
Molecular Formula C50H57NO17
Molecular Weight 944 g/mol
SMILES CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)OC8C(C(C(CO8)O)O)O)C)O
InChIKey ORKLEZFXASNLFJ-DYLQFHMVSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) typically synthesized?

10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is synthesized through a series of chemical react...

Compound Q&A

What industries use 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1)?

When handling 10-Deacetyl-7-xylosyl Paclitaxel (CAS: 90332-63-1), it is crucial to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...