Compound Q&A

What industries use Acalabrutinib (CAS: 1420477-60-6)?

Answer

Acalabrutinib
Acalabrutinib (CAS: 1420477-60-6) is primarily used in the pharmaceutical industry for the treatment of B-cell malignancies such as chronic lymphocytic leukemia (CLL) and small lymphocytic lymphoma (SLL). It has also shown promise in other hematological disorders and is being explored for its potential applications in oncology research. While not widely used in other industries, its unique properties make it a valuable research compound in areas such as drug discovery and development.

About

English Name Acalabrutinib
Molecular Formula C26H23N7O2
Molecular Weight 30.07 g/mol
SMILES CC#CC(=O)N1CCC[C@H]1c2nc(c3ccc(cc3)C(=O)Nc4ccccn4)c5c(N)nccn25
InChIKey WDENQIQQYWYTPO-IBGZPJMESA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acalabrutinib (CAS: 1420477-60-6)?

Acalabrutinib (CAS: 1420477-60-6) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is Acalabrutinib (CAS: 1420477-60-6) typically synthesized?

Acalabrutinib (CAS: 1420477-60-6) is synthesized through a multi-step process involving the modifica...

Compound Q&A

What precautions should be taken when handling Acalabrutinib (CAS: 1420477-60-6)?

When handling Acalabrutinib (CAS: 1420477-60-6), it is important to wear personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...