Compound Q&A

How is Acalabrutinib (CAS: 1420477-60-6) typically synthesized?

Answer

Acalabrutinib
Acalabrutinib (CAS: 1420477-60-6) is synthesized through a multi-step process involving the modification of a defined starting material. The synthesis typically involves a series of reactions including alkylation, amination, and acylation, with the use of specific catalysts and reagents. The final step involves purification and crystallization to obtain the desired product. The overall yield is around 50-60%, with high selectivity towards the target compound.

About

English Name Acalabrutinib
Molecular Formula C26H23N7O2
Molecular Weight 30.07 g/mol
SMILES CC#CC(=O)N1CCC[C@H]1c2nc(c3ccc(cc3)C(=O)Nc4ccccn4)c5c(N)nccn25
InChIKey WDENQIQQYWYTPO-IBGZPJMESA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Acalabrutinib (CAS: 1420477-60-6)?

Acalabrutinib (CAS: 1420477-60-6) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

What industries use Acalabrutinib (CAS: 1420477-60-6)?

Acalabrutinib (CAS: 1420477-60-6) is primarily used in the pharmaceutical industry for the treatment...

Compound Q&A

What precautions should be taken when handling Acalabrutinib (CAS: 1420477-60-6)?

When handling Acalabrutinib (CAS: 1420477-60-6), it is important to wear personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...