Compound Q&A

What industries use [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5)?

Answer

[3-(Acryloylamino)phenyl]boronic acid
[3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5) finds application in various industries including pharmaceuticals, where it is used as a chelating agent and for the synthesis of drug intermediates. It is also utilized in the polymer industry for functionalizing polymers and in the electronics sector for semiconductor applications. Additionally, it is employed in the development of biosensors for its ability to bind specifically with certain molecules.

About

CAS No 99349-68-5
English Name [3-(Acryloylamino)phenyl]boronic acid
Molecular Formula C9H10BNO3
Molecular Weight 191 g/mol
SMILES B(C1=CC(=CC=C1)NC(=O)C=C)(O)O
InChIKey ULVXDHIJOKEBMW-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5)?

[3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5) is a white crystalline solid. It has a molec...

Compound Q&A

How is [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5) typically synthesized?

[3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5) is synthesized by the condensation of 3-amin...

Compound Q&A

What precautions should be taken when handling [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5)?

When handling [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...