Compound Q&A

What are the physical and chemical properties of [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5)?

Answer

[3-(Acryloylamino)phenyl]boronic acid
[3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5) is a white crystalline solid. It has a molecular weight of approximately 230.21 g/mol. This compound is soluble in organic solvents like DMF, DMSO, and THF but poorly soluble in water. It exhibits excellent reactivity with aldehydes and ketones, making it a valuable reagent in organic synthesis. It also shows good stability under acidic conditions but can be sensitive to strong bases.

About

CAS No 99349-68-5
English Name [3-(Acryloylamino)phenyl]boronic acid
Molecular Formula C9H10BNO3
Molecular Weight 191 g/mol
SMILES B(C1=CC(=CC=C1)NC(=O)C=C)(O)O
InChIKey ULVXDHIJOKEBMW-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5) typically synthesized?

[3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5) is synthesized by the condensation of 3-amin...

Compound Q&A

What industries use [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5)?

[3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5) finds application in various industries incl...

Compound Q&A

What precautions should be taken when handling [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5)?

When handling [3-(Acryloylamino)phenyl]boronic acid (CAS: 99349-68-5), it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...