Compound Q&A

What industries use 3-(tert-Butyldimethylsilyloxy)glutaric anhydride (CAS: 91424-40-7)?

Answer

3-(tert-Butyldimethylsilyloxy)glutaric anhydride
3-(tert-Butyldimethylsilyloxy)glutaric anhydride is widely used in the pharmaceutical industry for the synthesis of various drug intermediates. It also finds applications in polymer synthesis and as a sensor material due to its reactive nature and stability.

About

CAS No 91424-40-7
English Name 3-(tert-Butyldimethylsilyloxy)glutaric anhydride
Molecular Formula C11H20O4Si
Molecular Weight 244.36299999999994 g/mol
SMILES CC(C)(C)[Si](C)(C)OC1CC(=O)OC(=O)C1
InChIKey RXAJGRHLLRGVSB-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(tert-Butyldimethylsilyloxy)glutaric anhydride (CAS: 91424-40-7)?

3-(tert-Butyldimethylsilyloxy)glutaric anhydride is a white crystalline solid with a molecular weigh...

Compound Q&A

How is 3-(tert-Butyldimethylsilyloxy)glutaric anhydride (CAS: 91424-40-7) typically synthesized?

3-(tert-Butyldimethylsilyloxy)glutaric anhydride is typically synthesized through the condensation r...

Compound Q&A

What precautions should be taken when handling 3-(tert-Butyldimethylsilyloxy)glutaric anhydride (CAS: 91424-40-7)?

When handling 3-(tert-Butyldimethylsilyloxy)glutaric anhydride, it is essential to use personal prot...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...