Compound Q&A

How is 3-(tert-Butyldimethylsilyloxy)glutaric anhydride (CAS: 91424-40-7) typically synthesized?

Answer

3-(tert-Butyldimethylsilyloxy)glutaric anhydride
3-(tert-Butyldimethylsilyloxy)glutaric anhydride is typically synthesized through the condensation reaction of 3-(tert-butyldimethylsilyloxy)glutaric acid with a strong acid catalyst, such as sulfuric acid. The reaction provides excellent yield and selectivity, making it a preferred method in organic synthesis.

About

CAS No 91424-40-7
English Name 3-(tert-Butyldimethylsilyloxy)glutaric anhydride
Molecular Formula C11H20O4Si
Molecular Weight 244.36 g/mol
SMILES CC(C)(C)[Si](C)(C)OC1CC(=O)OC(=O)C1
InChIKey RXAJGRHLLRGVSB-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(tert-Butyldimethylsilyloxy)glutaric anhydride (CAS: 91424-40-7)?

3-(tert-Butyldimethylsilyloxy)glutaric anhydride is a white crystalline solid with a molecular weigh...

Compound Q&A

What industries use 3-(tert-Butyldimethylsilyloxy)glutaric anhydride (CAS: 91424-40-7)?

3-(tert-Butyldimethylsilyloxy)glutaric anhydride is widely used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 3-(tert-Butyldimethylsilyloxy)glutaric anhydride (CAS: 91424-40-7)?

When handling 3-(tert-Butyldimethylsilyloxy)glutaric anhydride, it is essential to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...