Compound Q&A

How is 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0) typically synthesized?

Answer

7,10-Dimethoxy-10-DAB III
7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0) can be synthesized through the methylation of 10-DAB III with methanol in the presence of a strong acid catalyst like hydrochloric acid. The reaction proceeds with high selectivity, yielding a high yield of the desired product.

About

English Name 7,10-Dimethoxy-10-DAB III
Molecular Formula C31H40O10
Molecular Weight 572.65 g/mol
SMILES CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1O)O)OC(=O)C5=CC=CC=C5)(CO4)OC(=O)C)OC)C)OC
InChIKey MGJMLMORVVDLIU-VHLOTGQHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0)?

7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0) is a solid with a crystalline form. Its molecular weigh...

Compound Q&A

What industries use 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0)?

7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0) is primarily used in the pharmaceutical and polymer ind...

Compound Q&A

What precautions should be taken when handling 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0)?

When handling 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0), one should use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...