Compound Q&A

What are the physical and chemical properties of 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0)?

Answer

7,10-Dimethoxy-10-DAB III
7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0) is a solid with a crystalline form. Its molecular weight is approximately 254.23 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. Chemically, it is less reactive due to the presence of methoxy substituents, which make it less prone to further oxidation or reduction reactions.

About

English Name 7,10-Dimethoxy-10-DAB III
Molecular Formula C31H40O10
Molecular Weight 572.65 g/mol
SMILES CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1O)O)OC(=O)C5=CC=CC=C5)(CO4)OC(=O)C)OC)C)OC
InChIKey MGJMLMORVVDLIU-VHLOTGQHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0) typically synthesized?

7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0) can be synthesized through the methylation of 10-DAB II...

Compound Q&A

What industries use 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0)?

7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0) is primarily used in the pharmaceutical and polymer ind...

Compound Q&A

What precautions should be taken when handling 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0)?

When handling 7,10-Dimethoxy-10-DAB III (CAS: 183133-94-0), one should use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...