Compound Q&A

What precautions should be taken when handling Triphenylsilane (CAS: 789-25-3)?

Answer

Triphenylsilane
When handling Triphenylsilane (CAS: 789-25-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and protective clothing. Fume hoods should be used during operations to minimize exposure to the volatile compound. Spills should be cleaned up carefully using appropriate absorbents, and the area should be ventilated. Safety data sheets (SDS) should be consulted for detailed handling and disposal information.

About

CAS No 789-25-3
English Name Triphenylsilane
Molecular Formula C18H16Si
Molecular Weight 260.41 g/mol
EINECS 212-333-0
SMILES c1ccc(cc1)[SiH](c2ccccc2)c3ccccc3
InChIKey AKQNYQDSIDKVJZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triphenylsilane (CAS: 789-25-3)?

Triphenylsilane (CAS: 789-25-3) is a colorless to light yellow liquid with a molecular weight of app...

Compound Q&A

How is Triphenylsilane (CAS: 789-25-3) typically synthesized?

Triphenylsilane (CAS: 789-25-3) is typically synthesized by the reaction of triphenyl germanium and ...

Compound Q&A

What industries use Triphenylsilane (CAS: 789-25-3)?

Triphenylsilane (CAS: 789-25-3) is widely used in industries such as pharmaceuticals, where it serve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...