Compound Q&A

What are the physical and chemical properties of Triphenylsilane (CAS: 789-25-3)?

Answer

Triphenylsilane
Triphenylsilane (CAS: 789-25-3) is a colorless to light yellow liquid with a molecular weight of approximately 278.32 g/mol. It has a low solubility in water but is highly soluble in organic solvents. Chemically, it is less reactive compared to other organosilanes, making it useful in various applications. It has a specific gravity of around 0.96 and a melting point of -40°C, boiling point of 110°C, and vapor pressure of 1 mmHg at 25°C.

About

CAS No 789-25-3
English Name Triphenylsilane
Molecular Formula C18H16Si
Molecular Weight 260.41 g/mol
EINECS 212-333-0
SMILES c1ccc(cc1)[SiH](c2ccccc2)c3ccccc3
InChIKey AKQNYQDSIDKVJZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Triphenylsilane (CAS: 789-25-3) typically synthesized?

Triphenylsilane (CAS: 789-25-3) is typically synthesized by the reaction of triphenyl germanium and ...

Compound Q&A

What industries use Triphenylsilane (CAS: 789-25-3)?

Triphenylsilane (CAS: 789-25-3) is widely used in industries such as pharmaceuticals, where it serve...

Compound Q&A

What precautions should be taken when handling Triphenylsilane (CAS: 789-25-3)?

When handling Triphenylsilane (CAS: 789-25-3), it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...