Compound Q&A

What industries use Triphenylsilane (CAS: 789-25-3)?

Answer

Triphenylsilane
Triphenylsilane (CAS: 789-25-3) is widely used in industries such as pharmaceuticals, where it serves as a protecting group for silicon-containing compounds. It is also used in polymer synthesis, particularly in the preparation of organosilicon polymers. Additionally, it finds applications in semiconductor manufacturing for surface protection and in the production of chemical sensors for their dielectric properties.

About

CAS No 789-25-3
English Name Triphenylsilane
Molecular Formula C18H16Si
Molecular Weight 260.41 g/mol
EINECS 212-333-0
SMILES c1ccc(cc1)[SiH](c2ccccc2)c3ccccc3
InChIKey AKQNYQDSIDKVJZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triphenylsilane (CAS: 789-25-3)?

Triphenylsilane (CAS: 789-25-3) is a colorless to light yellow liquid with a molecular weight of app...

Compound Q&A

How is Triphenylsilane (CAS: 789-25-3) typically synthesized?

Triphenylsilane (CAS: 789-25-3) is typically synthesized by the reaction of triphenyl germanium and ...

Compound Q&A

What precautions should be taken when handling Triphenylsilane (CAS: 789-25-3)?

When handling Triphenylsilane (CAS: 789-25-3), it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...