Compound Q&A

What industries use Pemetrexed (CAS: 137281-23-3)?

Answer

Pemetrexed
Pemetrexed is primarily used in the pharmaceutical industry, specifically for the treatment of cancer. It is also of interest in the development of new drugs and as a precursor in the synthesis of other bioactive compounds. Limited applications exist in the polymer and chemical industries for research purposes.

About

English Name Pemetrexed
Molecular Formula C20H21N5O6
Molecular Weight 427.42 g/mol
SMILES Nc1nc2[nH]cc(CCc3ccc(cc3)C(=O)N[C@@H](CCC(=O)O)C(=O)O)c2c(=O)[nH]1
InChIKey WBXPDJSOTKVWSJ-ZDUSSCGKSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pemetrexed (CAS: 137281-23-3)?

Pemetrexed is a white to off-white crystalline powder with a molecular weight of approximately 379.8...

Compound Q&A

How is Pemetrexed (CAS: 137281-23-3) typically synthesized?

Pemetrexed is typically synthesized via a multi-step process involving nucleophilic substitution rea...

Compound Q&A

What precautions should be taken when handling Pemetrexed (CAS: 137281-23-3)?

Pemetrexed should be handled in a well-ventilated area with the use of personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...