Compound Q&A

What are the physical and chemical properties of Pemetrexed (CAS: 137281-23-3)?

Answer

Pemetrexed
Pemetrexed is a white to off-white crystalline powder with a molecular weight of approximately 379.88 g/mol. It is poorly soluble in water but soluble in ethanol and acetonitrile. It is highly reactive towards metal ions and susceptible to hydrolysis under acidic or basic conditions.

About

English Name Pemetrexed
Molecular Formula C20H21N5O6
Molecular Weight 427.42 g/mol
SMILES Nc1nc2[nH]cc(CCc3ccc(cc3)C(=O)N[C@@H](CCC(=O)O)C(=O)O)c2c(=O)[nH]1
InChIKey WBXPDJSOTKVWSJ-ZDUSSCGKSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Pemetrexed (CAS: 137281-23-3) typically synthesized?

Pemetrexed is typically synthesized via a multi-step process involving nucleophilic substitution rea...

Compound Q&A

What industries use Pemetrexed (CAS: 137281-23-3)?

Pemetrexed is primarily used in the pharmaceutical industry, specifically for the treatment of cance...

Compound Q&A

What precautions should be taken when handling Pemetrexed (CAS: 137281-23-3)?

Pemetrexed should be handled in a well-ventilated area with the use of personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...