Compound Q&A

What industries use Tri-2-furylphosphine (CAS: 5518-52-5)?

Answer

Tri-2-furylphosphine
Tri-2-furylphosphine (CAS: 5518-52-5) is used in various industries due to its reactivity and reducing properties. It is primarily used in the pharmaceutical industry for the synthesis of certain drug precursors, in the polymer industry for modifying polymer properties, in the sensor industry for sensing specific gases, and in the semiconductor industry for etching and deposition processes. Its versatility makes it a valuable compound in these sectors.

About

CAS No 5518-52-5
English Name Tri-2-furylphosphine
Molecular Formula C12H9O3P
Molecular Weight 232.18 g/mol
SMILES C1=COC(=C1)P(C2=CC=CO2)C3=CC=CO3
InChIKey DLQYXUGCCKQSRJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tri-2-furylphosphine (CAS: 5518-52-5)?

Tri-2-furylphosphine (CAS: 5518-52-5) is a colorless, flammable liquid at room temperature. It has a...

Compound Q&A

How is Tri-2-furylphosphine (CAS: 5518-52-5) typically synthesized?

Tri-2-furylphosphine is typically synthesized by the reaction of diphenylphosphine with 2-furylboron...

Compound Q&A

What precautions should be taken when handling Tri-2-furylphosphine (CAS: 5518-52-5)?

Tri-2-furylphosphine (CAS: 5518-52-5) requires special handling due to its flammability and reactivi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...