Compound Q&A

How is Tri-2-furylphosphine (CAS: 5518-52-5) typically synthesized?

Answer

Tri-2-furylphosphine
Tri-2-furylphosphine is typically synthesized by the reaction of diphenylphosphine with 2-furylboronic acid. The reaction is catalyzed by palladium(II) acetate and a base such as triphenylphosphine. The yield is generally high, and the product is isolated by filtration and recrystallization. This method allows for the production of a pure and well-defined compound suitable for various applications.

About

CAS No 5518-52-5
English Name Tri-2-furylphosphine
Molecular Formula C12H9O3P
Molecular Weight 232.18 g/mol
SMILES C1=COC(=C1)P(C2=CC=CO2)C3=CC=CO3
InChIKey DLQYXUGCCKQSRJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tri-2-furylphosphine (CAS: 5518-52-5)?

Tri-2-furylphosphine (CAS: 5518-52-5) is a colorless, flammable liquid at room temperature. It has a...

Compound Q&A

What industries use Tri-2-furylphosphine (CAS: 5518-52-5)?

Tri-2-furylphosphine (CAS: 5518-52-5) is used in various industries due to its reactivity and reduci...

Compound Q&A

What precautions should be taken when handling Tri-2-furylphosphine (CAS: 5518-52-5)?

Tri-2-furylphosphine (CAS: 5518-52-5) requires special handling due to its flammability and reactivi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...