Compound Q&A

What are the physical and chemical properties of Tri-2-furylphosphine (CAS: 5518-52-5)?

Answer

Tri-2-furylphosphine
Tri-2-furylphosphine (CAS: 5518-52-5) is a colorless, flammable liquid at room temperature. It has a molecular weight of approximately 152.17 g/mol and a boiling point of around 130°C. The compound is slightly soluble in water but miscible with most organic solvents. It is a strong reducing agent and reacts readily with halogens, oxidizing agents, and certain metal ions. Its reactivity makes it useful but also requires careful handling in chemical processes.

About

CAS No 5518-52-5
English Name Tri-2-furylphosphine
Molecular Formula C12H9O3P
Molecular Weight 232.18 g/mol
SMILES C1=COC(=C1)P(C2=CC=CO2)C3=CC=CO3
InChIKey DLQYXUGCCKQSRJ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Tri-2-furylphosphine (CAS: 5518-52-5) typically synthesized?

Tri-2-furylphosphine is typically synthesized by the reaction of diphenylphosphine with 2-furylboron...

Compound Q&A

What industries use Tri-2-furylphosphine (CAS: 5518-52-5)?

Tri-2-furylphosphine (CAS: 5518-52-5) is used in various industries due to its reactivity and reduci...

Compound Q&A

What precautions should be taken when handling Tri-2-furylphosphine (CAS: 5518-52-5)?

Tri-2-furylphosphine (CAS: 5518-52-5) requires special handling due to its flammability and reactivi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...