Compound Q&A

What precautions should be taken when handling (2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid (CAS: 150629-67-7)?

Answer

(2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
When handling this compound, it is important to work in a well-ventilated area or under a fume hood. Use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the compound is stored in a cool, dry place away from moisture and light. In case of a spill, neutralize the area before cleaning up. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name (2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Molecular Formula C31H36N2O6
Molecular Weight 532.64 g/mol
SMILES CC(=C1C(=O)CC(C)(C)CC1=O)NCCCC[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C(=O)O
InChIKey ZPSRBXWVBNVFTO-VWLOTQADSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid (CAS: 150629-67-7) typically synthesized?

This compound is typically synthesized via a peptide coupling reaction using fluorenylmethyloxycarbo...

Compound Q&A

What industries use (2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid (CAS: 150629-67-7)?

This compound is primarily used in the pharmaceutical and biotechnology industries for the synthesis...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...