Compound Q&A

What are the physical and chemical properties of (2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid (CAS: 150629-67-7)?

Answer

(2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
This compound has a crystalline form and a molecular weight of approximately 526.54 g/mol. It is sparingly soluble in water and highly soluble in organic solvents such as DMSO and DMF. It exhibits good reactivity with nucleophiles, making it suitable for peptide coupling reactions. It is stable under normal storage conditions but should be protected from moisture and light.

About

English Name (2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Molecular Formula C31H36N2O6
Molecular Weight 532.64 g/mol
SMILES CC(=C1C(=O)CC(C)(C)CC1=O)NCCCC[C@H](NC(=O)OCC2c3ccccc3-c4ccccc24)C(=O)O
InChIKey ZPSRBXWVBNVFTO-VWLOTQADSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid (CAS: 150629-67-7) typically synthesized?

This compound is typically synthesized via a peptide coupling reaction using fluorenylmethyloxycarbo...

Compound Q&A

What industries use (2S)-6-{[1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid (CAS: 150629-67-7)?

This compound is primarily used in the pharmaceutical and biotechnology industries for the synthesis...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...