Compound Q&A

What precautions should be taken when handling 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

Answer

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid
When handling 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure to vapors. Spills should be carefully cleaned up using suitable absorbent materials, and the area should be thoroughly washed down. Always consult a Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

CAS No 22494-42-4
English Name 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid
Molecular Formula C13H8F2O3
Molecular Weight 250.2 g/mol
SMILES C1=CC(=C(C=C1C2=C(C=C(C=C2)F)F)C(=O)O)O
InChIKey HUPFGZXOMWLGNK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) is a white crystalline solid wi...

Compound Q&A

How is 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) typically synthesized?

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid is synthesized through a multi-step process invol...

Compound Q&A

What industries use 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) is primarily used in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...