Compound Q&A

What industries use 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

Answer

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid
2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) is primarily used in the pharmaceutical industry for the synthesis of various drug molecules. It can also be employed in the production of functional polymers, sensors, and semiconductors. Due to its specific chemical structure, it serves as a valuable precursor in materials science and chemical research.

About

CAS No 22494-42-4
English Name 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid
Molecular Formula C13H8F2O3
Molecular Weight 250.2 g/mol
SMILES C1=CC(=C(C=C1C2=C(C=C(C=C2)F)F)C(=O)O)O
InChIKey HUPFGZXOMWLGNK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) is a white crystalline solid wi...

Compound Q&A

How is 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) typically synthesized?

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid is synthesized through a multi-step process invol...

Compound Q&A

What precautions should be taken when handling 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

When handling 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...