Compound Q&A

What are the physical and chemical properties of 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

Answer

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid
2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) is a white crystalline solid with a molecular weight of approximately 296.05 g/mol. It is poorly soluble in water but soluble in common organic solvents like methanol and ethanol. The compound is moderately acidic and can react with bases. It exhibits good stability under normal conditions but may degrade at high temperatures or under strong acidic or basic conditions.

About

CAS No 22494-42-4
English Name 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid
Molecular Formula C13H8F2O3
Molecular Weight 250.2 g/mol
SMILES C1=CC(=C(C=C1C2=C(C=C(C=C2)F)F)C(=O)O)O
InChIKey HUPFGZXOMWLGNK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) typically synthesized?

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid is synthesized through a multi-step process invol...

Compound Q&A

What industries use 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4)?

When handling 2',4'-Difluoro-4-hydroxy-3-biphenylcarboxylic acid (CAS: 22494-42-4), it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...