Compound Q&A

What industries use 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

Answer

1-Fluoro-3-nitrobenzene
1-Fluoro-3-nitrobenzene (CAS: 402-67-5) is used in the pharmaceutical industry for the synthesis of various organic compounds. It is also found in the chemical industry for the production of dyes, pigments, and other organic intermediates. Additionally, this compound finds applications in the polymer industry as a monomer for certain types of plastics and in the electronics industry for the fabrication of semiconductors.

About

CAS No 402-67-5
English Name 1-Fluoro-3-nitrobenzene
Molecular Formula C6H4FNO2
Molecular Weight 141.1 g/mol
SMILES C1=CC(=CC(=C1)F)[N+](=O)[O-]
InChIKey WMASLRCNNKMRFP-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

1-Fluoro-3-nitrobenzene (CAS: 402-67-5) is a yellow crystalline solid with a molecular weight of app...

Compound Q&A

How is 1-Fluoro-3-nitrobenzene (CAS: 402-67-5) typically synthesized?

1-Fluoro-3-nitrobenzene is typically synthesized through the nitration of 1-fluorobenzene. This proc...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

Proper handling of 1-Fluoro-3-nitrobenzene (CAS: 402-67-5) requires the use of personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...